About (4,4-difluoro-1-oxo-2,3-dihydroisoquinolin-3-yl) 4-methylbenzenesulfonate
(4,4-difluoro-1-oxo-2,3-dihydroisoquinolin-3-yl) 4-methylbenzenesulfonate (PubChem CID 162401866) has the molecular formula C16H13F2NO4S
and a molecular weight of 353.35 g/mol. Its IUPAC name is (4,4-difluoro-1-oxo-2,3-dihydroisoquinolin-3-yl) 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (4,4-difluoro-1-oxo-2,3-dihydroisoquinolin-3-yl) 4-methylbenzenesulfonate |
| PubChem CID | 162401866 |
| Molecular Formula | C16H13F2NO4S |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | (4,4-difluoro-1-oxo-2,3-dihydroisoquinolin-3-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2NC(=O)c3ccccc3C2(F)F)cc1 |
| InChI | InChI=1S/C16H13F2NO4S/c1-10-6-8-11(9-7-10)24(21,22)23-15-16(17,18)13-5-3-2-4-12(13)14(20)19-15/h2-9,15H,1H3,(H,19,20) |
| InChIKey | QUYJBJZYCFRLJW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4,4-difluoro-1-oxo-2,3-dihydroisoquinolin-3-yl) 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluoro-1-oxo-2,3-dihydroisoquinolin-3-yl) 4-methylbenzenesulfonate?
The IUPAC name of (4,4-difluoro-1-oxo-2,3-dihydroisoquinolin-3-yl) 4-methylbenzenesulfonate (CID 162401866) is (4,4-difluoro-1-oxo-2,3-dihydroisoquinolin-3-yl) 4-methylbenzenesulfonate.
What is the SMILES notation for (4,4-difluoro-1-oxo-2,3-dihydroisoquinolin-3-yl) 4-methylbenzenesulfonate?
The canonical SMILES for (4,4-difluoro-1-oxo-2,3-dihydroisoquinolin-3-yl) 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OC2NC(=O)c3ccccc3C2(F)F)cc1.
What is the InChIKey of (4,4-difluoro-1-oxo-2,3-dihydroisoquinolin-3-yl) 4-methylbenzenesulfonate?
The InChIKey is QUYJBJZYCFRLJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F2NO4S/c1-10-6-8-11(9-7-10)24(21,22)23-15-16(17,18)13-5-3-2-4-12(13)14(20)19-15/h2-9,15H,1H3,(H,19,20).
What are the key properties of (4,4-difluoro-1-oxo-2,3-dihydroisoquinolin-3-yl) 4-methylbenzenesulfonate?
(4,4-difluoro-1-oxo-2,3-dihydroisoquinolin-3-yl) 4-methylbenzenesulfonate has a molecular weight of 353.35 g/mol, XLogP of 2.56, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluoro-1-oxo-2,3-dihydroisoquinolin-3-yl) 4-methylbenzenesulfonate is sourced from PubChem (CID 162401866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).