About [2-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoyl]iminorhodium
[2-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoyl]iminorhodium (PubChem CID 162401868) has the molecular formula C16H13F2NO4RhS
and a molecular weight of 456.25 g/mol. Its IUPAC name is [2-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoyl]iminorhodium.
Molecular Properties
| Compound Name | [2-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoyl]iminorhodium |
| PubChem CID | 162401868 |
| Molecular Formula | C16H13F2NO4RhS |
| Molecular Weight | 456.25 g/mol |
| Exact Mass | 455.96 |
| IUPAC Name | [2-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoyl]iminorhodium |
| SMILES | Cc1ccc(S(=O)(=O)OCC(F)(F)c2ccccc2C(=O)N=[Rh])cc1 |
| InChI | InChI=1S/C16H13F2NO4S.Rh/c1-11-6-8-12(9-7-11)24(21,22)23-10-16(17,18)14-5-3-2-4-13(14)15(19)20;/h2-9H,10H2,1H3; |
| InChIKey | LONXOJMFFMHMSV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoyl]iminorhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoyl]iminorhodium?
The IUPAC name of [2-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoyl]iminorhodium (CID 162401868) is [2-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoyl]iminorhodium.
What is the SMILES notation for [2-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoyl]iminorhodium?
The canonical SMILES for [2-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoyl]iminorhodium is Cc1ccc(S(=O)(=O)OCC(F)(F)c2ccccc2C(=O)N=[Rh])cc1.
What is the InChIKey of [2-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoyl]iminorhodium?
The InChIKey is LONXOJMFFMHMSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F2NO4S.Rh/c1-11-6-8-12(9-7-11)24(21,22)23-10-16(17,18)14-5-3-2-4-13(14)15(19)20;/h2-9H,10H2,1H3;.
What are the key properties of [2-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoyl]iminorhodium?
[2-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoyl]iminorhodium has a molecular weight of 456.25 g/mol, XLogP of 3.36, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]benzoyl]iminorhodium is sourced from PubChem (CID 162401868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).