About (2S)-3,4-dihydro-2H-pyrrol-1-ium-2-carboxylic acid
(2S)-3,4-dihydro-2H-pyrrol-1-ium-2-carboxylic acid (PubChem CID 162401953) has the molecular formula C5H8NO2+
and a molecular weight of 114.12 g/mol. Its IUPAC name is (2S)-3,4-dihydro-2H-pyrrol-1-ium-2-carboxylic acid.
Molecular Properties
| Compound Name | (2S)-3,4-dihydro-2H-pyrrol-1-ium-2-carboxylic acid |
| PubChem CID | 162401953 |
| Molecular Formula | C5H8NO2+ |
| Molecular Weight | 114.12 g/mol |
| Exact Mass | 114.05 |
| IUPAC Name | (2S)-3,4-dihydro-2H-pyrrol-1-ium-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCC=[NH+]1 |
| InChI | InChI=1S/C5H7NO2/c7-5(8)4-2-1-3-6-4/h3-4H,1-2H2,(H,7,8)/p+1/t4-/m0/s1 |
| InChIKey | DWAKNKKXGALPNW-BYPYZUCNSA-O |
| XLogP | -1.62 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.12 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-3,4-dihydro-2H-pyrrol-1-ium-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3,4-dihydro-2H-pyrrol-1-ium-2-carboxylic acid?
The IUPAC name of (2S)-3,4-dihydro-2H-pyrrol-1-ium-2-carboxylic acid (CID 162401953) is (2S)-3,4-dihydro-2H-pyrrol-1-ium-2-carboxylic acid.
What is the SMILES notation for (2S)-3,4-dihydro-2H-pyrrol-1-ium-2-carboxylic acid?
The canonical SMILES for (2S)-3,4-dihydro-2H-pyrrol-1-ium-2-carboxylic acid is O=C(O)[C@@H]1CCC=[NH+]1.
What is the InChIKey of (2S)-3,4-dihydro-2H-pyrrol-1-ium-2-carboxylic acid?
The InChIKey is DWAKNKKXGALPNW-BYPYZUCNSA-O. The full InChI is InChI=1S/C5H7NO2/c7-5(8)4-2-1-3-6-4/h3-4H,1-2H2,(H,7,8)/p+1/t4-/m0/s1.
What are the key properties of (2S)-3,4-dihydro-2H-pyrrol-1-ium-2-carboxylic acid?
(2S)-3,4-dihydro-2H-pyrrol-1-ium-2-carboxylic acid has a molecular weight of 114.12 g/mol, XLogP of -1.62, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3,4-dihydro-2H-pyrrol-1-ium-2-carboxylic acid is sourced from PubChem (CID 162401953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).