About (2R)-2-[3,3-difluoro-2-(4-phenylphenyl)prop-2-enyl]oxolane
(2R)-2-[3,3-difluoro-2-(4-phenylphenyl)prop-2-enyl]oxolane (PubChem CID 162402006) has the molecular formula C19H18F2O
and a molecular weight of 300.35 g/mol. Its IUPAC name is (2R)-2-[3,3-difluoro-2-(4-phenylphenyl)prop-2-enyl]oxolane.
Molecular Properties
| Compound Name | (2R)-2-[3,3-difluoro-2-(4-phenylphenyl)prop-2-enyl]oxolane |
| PubChem CID | 162402006 |
| Molecular Formula | C19H18F2O |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (2R)-2-[3,3-difluoro-2-(4-phenylphenyl)prop-2-enyl]oxolane |
| SMILES | FC(F)=C(C[C@H]1CCCO1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H18F2O/c20-19(21)18(13-17-7-4-12-22-17)16-10-8-15(9-11-16)14-5-2-1-3-6-14/h1-3,5-6,8-11,17H,4,7,12-13H2/t17-/m1/s1 |
| InChIKey | HREBWVVTOIYWSJ-QGZVFWFLSA-N |
| XLogP | 5.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2-[3,3-difluoro-2-(4-phenylphenyl)prop-2-enyl]oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[3,3-difluoro-2-(4-phenylphenyl)prop-2-enyl]oxolane?
The IUPAC name of (2R)-2-[3,3-difluoro-2-(4-phenylphenyl)prop-2-enyl]oxolane (CID 162402006) is (2R)-2-[3,3-difluoro-2-(4-phenylphenyl)prop-2-enyl]oxolane.
What is the SMILES notation for (2R)-2-[3,3-difluoro-2-(4-phenylphenyl)prop-2-enyl]oxolane?
The canonical SMILES for (2R)-2-[3,3-difluoro-2-(4-phenylphenyl)prop-2-enyl]oxolane is FC(F)=C(C[C@H]1CCCO1)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of (2R)-2-[3,3-difluoro-2-(4-phenylphenyl)prop-2-enyl]oxolane?
The InChIKey is HREBWVVTOIYWSJ-QGZVFWFLSA-N. The full InChI is InChI=1S/C19H18F2O/c20-19(21)18(13-17-7-4-12-22-17)16-10-8-15(9-11-16)14-5-2-1-3-6-14/h1-3,5-6,8-11,17H,4,7,12-13H2/t17-/m1/s1.
What are the key properties of (2R)-2-[3,3-difluoro-2-(4-phenylphenyl)prop-2-enyl]oxolane?
(2R)-2-[3,3-difluoro-2-(4-phenylphenyl)prop-2-enyl]oxolane has a molecular weight of 300.35 g/mol, XLogP of 5.53, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[3,3-difluoro-2-(4-phenylphenyl)prop-2-enyl]oxolane is sourced from PubChem (CID 162402006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).