C19H31NO3Si — CID 162402021
tert-butyl 3-[(2R)-2-phenyl-2-trimethylsilyloxyethyl]azetidine-1-carboxylate (PubChem CID 162402021) has the molecular formula C19H31NO3Si and a molecular weight of 349.55 g/mol. Its IUPAC name is tert-butyl 3-[(2R)-2-phenyl-2-trimethylsilyloxyethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2R)-2-phenyl-2-trimethylsilyloxyethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 162402021 |
| Molecular Formula | C19H31NO3Si |
| Molecular Weight | 349.55 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | tert-butyl 3-[(2R)-2-phenyl-2-trimethylsilyloxyethyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C[C@@H](O[Si](C)(C)C)c2ccccc2)C1 |
| InChI | InChI=1S/C19H31NO3Si/c1-19(2,3)22-18(21)20-13-15(14-20)12-17(23-24(4,5)6)16-10-8-7-9-11-16/h7-11,15,17H,12-14H2,1-6H3/t17-/m1/s1 |
| InChIKey | ZWHVUCSRLFDJFE-QGZVFWFLSA-N |
| XLogP | 4.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|