C14H14N2O3 — CID 162402033
(4R)-1,1'-dimethylspiro[3H-quinoline-4,3'-pyrrolidine]-2,2',5'-trione (PubChem CID 162402033) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is (4R)-1,1'-dimethylspiro[3H-quinoline-4,3'-pyrrolidine]-2,2',5'-trione.
| Compound Name | (4R)-1,1'-dimethylspiro[3H-quinoline-4,3'-pyrrolidine]-2,2',5'-trione |
|---|---|
| PubChem CID | 162402033 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (4R)-1,1'-dimethylspiro[3H-quinoline-4,3'-pyrrolidine]-2,2',5'-trione |
| SMILES | CN1C(=O)C[C@@]2(CC(=O)N(C)c3ccccc32)C1=O |
| InChI | InChI=1S/C14H14N2O3/c1-15-10-6-4-3-5-9(10)14(7-11(15)17)8-12(18)16(2)13(14)19/h3-6H,7-8H2,1-2H3/t14-/m1/s1 |
| InChIKey | VZYGOURFIIOULQ-CQSZACIVSA-N |
| XLogP | 0.68 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|