C17H20F9IO4 — CID 162402155
diethyl 3-(iodomethyl)-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)cyclopentane-1,1-dicarboxylate (PubChem CID 162402155) has the molecular formula C17H20F9IO4 and a molecular weight of 586.23 g/mol. Its IUPAC name is diethyl 3-(iodomethyl)-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 3-(iodomethyl)-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 162402155 |
| Molecular Formula | C17H20F9IO4 |
| Molecular Weight | 586.23 g/mol |
| Exact Mass | 586.03 |
| IUPAC Name | diethyl 3-(iodomethyl)-4-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(CI)C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C17H20F9IO4/c1-3-30-11(28)13(12(29)31-4-2)5-9(10(6-13)8-27)7-14(18,19)15(20,21)16(22,23)17(24,25)26/h9-10H,3-8H2,1-2H3 |
| InChIKey | SXAWKKLGAFZIPX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.23 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|