About (3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one
(3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one (PubChem CID 162402216) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is (3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one.
Molecular Properties
| Compound Name | (3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one |
| PubChem CID | 162402216 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one |
| SMILES | CC1(C)C=C[C@]2(C)C(=O)C=C[C@H]12 |
| InChI | InChI=1S/C11H14O/c1-10(2)6-7-11(3)8(10)4-5-9(11)12/h4-8H,1-3H3/t8-,11+/m1/s1 |
| InChIKey | UYAPEPGSLOIEKZ-KCJUWKMLSA-N |
| XLogP | 2.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one?
The IUPAC name of (3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one (CID 162402216) is (3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one.
What is the SMILES notation for (3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one?
The canonical SMILES for (3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one is CC1(C)C=C[C@]2(C)C(=O)C=C[C@H]12.
What is the InChIKey of (3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one?
The InChIKey is UYAPEPGSLOIEKZ-KCJUWKMLSA-N. The full InChI is InChI=1S/C11H14O/c1-10(2)6-7-11(3)8(10)4-5-9(11)12/h4-8H,1-3H3/t8-,11+/m1/s1.
What are the key properties of (3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one?
(3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one has a molecular weight of 162.23 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one is sourced from PubChem (CID 162402216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).