C11H14O — CID 162402216
(3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one (PubChem CID 162402216) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is (3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one.
| Compound Name | (3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one |
|---|---|
| PubChem CID | 162402216 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (3aR,6aS)-4,4,6a-trimethyl-3aH-pentalen-1-one |
| SMILES | CC1(C)C=C[C@]2(C)C(=O)C=C[C@H]12 |
| InChI | InChI=1S/C11H14O/c1-10(2)6-7-11(3)8(10)4-5-9(11)12/h4-8H,1-3H3/t8-,11+/m1/s1 |
| InChIKey | UYAPEPGSLOIEKZ-KCJUWKMLSA-N |
| XLogP | 2.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|