C25H46O3Si — CID 162402328
[(2S)-5a,9b-dimethyl-2-(2-methylprop-1-enyl)-7-triethylsilyloxy-1,2,3a,4,5,6,7,8,9,9a-decahydrobenzo[e][1]benzofuran-6-yl]methanol (PubChem CID 162402328) has the molecular formula C25H46O3Si and a molecular weight of 422.73 g/mol. Its IUPAC name is [(2S)-5a,9b-dimethyl-2-(2-methylprop-1-enyl)-7-triethylsilyloxy-1,2,3a,4,5,6,7,8,9,9a-decahydrobenzo[e][1]benzofuran-6-yl]methanol.
| Compound Name | [(2S)-5a,9b-dimethyl-2-(2-methylprop-1-enyl)-7-triethylsilyloxy-1,2,3a,4,5,6,7,8,9,9a-decahydrobenzo[e][1]benzofuran-6-yl]methanol |
|---|---|
| PubChem CID | 162402328 |
| Molecular Formula | C25H46O3Si |
| Molecular Weight | 422.73 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | [(2S)-5a,9b-dimethyl-2-(2-methylprop-1-enyl)-7-triethylsilyloxy-1,2,3a,4,5,6,7,8,9,9a-decahydrobenzo[e][1]benzofuran-6-yl]methanol |
| SMILES | CC[Si](CC)(CC)OC1CCC2C3(C)C[C@@H](C=C(C)C)OC3CCC2(C)C1CO |
| InChI | InChI=1S/C25H46O3Si/c1-8-29(9-2,10-3)28-21-11-12-22-24(6,20(21)17-26)14-13-23-25(22,7)16-19(27-23)15-18(4)5/h15,19-23,26H,8-14,16-17H2,1-7H3/t19-,20?,21?,22?,23?,24?,25?/m1/s1 |
| InChIKey | NGGKEISEZFYOCR-CBOQVEOOSA-N |
| XLogP | 6.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.73 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|