C20H30O2 — CID 162402346
(1R,6S,9R,10S,14S)-5-methoxy-6,11,11,14-tetramethyltetracyclo[7.6.0.01,6.010,14]pentadec-4-en-3-one (PubChem CID 162402346) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1R,6S,9R,10S,14S)-5-methoxy-6,11,11,14-tetramethyltetracyclo[7.6.0.01,6.010,14]pentadec-4-en-3-one.
| Compound Name | (1R,6S,9R,10S,14S)-5-methoxy-6,11,11,14-tetramethyltetracyclo[7.6.0.01,6.010,14]pentadec-4-en-3-one |
|---|---|
| PubChem CID | 162402346 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1R,6S,9R,10S,14S)-5-methoxy-6,11,11,14-tetramethyltetracyclo[7.6.0.01,6.010,14]pentadec-4-en-3-one |
| SMILES | COC1=CC(=O)C[C@]23C[C@]4(C)CCC(C)(C)[C@@H]4[C@H]2CC[C@]13C |
| InChI | InChI=1S/C20H30O2/c1-17(2)8-9-18(3)12-20-11-13(21)10-15(22-5)19(20,4)7-6-14(20)16(17)18/h10,14,16H,6-9,11-12H2,1-5H3/t14-,16+,18+,19-,20+/m1/s1 |
| InChIKey | MZAOEABZGMLGIA-MKFRZFLASA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |