C13H14O4 — CID 162402727
[(1S,2R,6S)-4-(3-methylbut-3-en-1-ynyl)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl] acetate (PubChem CID 162402727) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is [(1S,2R,6S)-4-(3-methylbut-3-en-1-ynyl)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl] acetate.
| Compound Name | [(1S,2R,6S)-4-(3-methylbut-3-en-1-ynyl)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl] acetate |
|---|---|
| PubChem CID | 162402727 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | [(1S,2R,6S)-4-(3-methylbut-3-en-1-ynyl)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl] acetate |
| SMILES | C=C(C)C#CC1C[C@@H](OC(C)=O)[C@@H]2O[C@@H]2C1=O |
| InChI | InChI=1S/C13H14O4/c1-7(2)4-5-9-6-10(16-8(3)14)12-13(17-12)11(9)15/h9-10,12-13H,1,6H2,2-3H3/t9?,10-,12+,13-/m1/s1 |
| InChIKey | JJFXYYWBJSMOTP-AABPYCQOSA-N |
| XLogP | 0.85 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|