C14H15F3N2OS — CID 162402825
[(2R)-thiolan-2-yl]-[1-[5-(trifluoromethyl)-2-pyridinyl]azetidin-3-yl]methanone (PubChem CID 162402825) has the molecular formula C14H15F3N2OS and a molecular weight of 316.35 g/mol. Its IUPAC name is [(2R)-thiolan-2-yl]-[1-[5-(trifluoromethyl)-2-pyridinyl]azetidin-3-yl]methanone.
| Compound Name | [(2R)-thiolan-2-yl]-[1-[5-(trifluoromethyl)-2-pyridinyl]azetidin-3-yl]methanone |
|---|---|
| PubChem CID | 162402825 |
| Molecular Formula | C14H15F3N2OS |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | [(2R)-thiolan-2-yl]-[1-[5-(trifluoromethyl)-2-pyridinyl]azetidin-3-yl]methanone |
| SMILES | O=C(C1CN(c2ccc(C(F)(F)F)cn2)C1)[C@H]1CCCS1 |
| InChI | InChI=1S/C14H15F3N2OS/c15-14(16,17)10-3-4-12(18-6-10)19-7-9(8-19)13(20)11-2-1-5-21-11/h3-4,6,9,11H,1-2,5,7-8H2/t11-/m1/s1 |
| InChIKey | NQDZJUYFRCLMQO-LLVKDONJSA-N |
| XLogP | 3.00 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |