C23H22O6 — CID 162402871
dimethyl 3-(2-oxo-2-phenylmethoxyethyl)-1H-naphthalene-2,2-dicarboxylate (PubChem CID 162402871) has the molecular formula C23H22O6 and a molecular weight of 394.42 g/mol. Its IUPAC name is dimethyl 3-(2-oxo-2-phenylmethoxyethyl)-1H-naphthalene-2,2-dicarboxylate.
| Compound Name | dimethyl 3-(2-oxo-2-phenylmethoxyethyl)-1H-naphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 162402871 |
| Molecular Formula | C23H22O6 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | dimethyl 3-(2-oxo-2-phenylmethoxyethyl)-1H-naphthalene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2ccccc2C=C1CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H22O6/c1-27-21(25)23(22(26)28-2)14-18-11-7-6-10-17(18)12-19(23)13-20(24)29-15-16-8-4-3-5-9-16/h3-12H,13-15H2,1-2H3 |
| InChIKey | KXJSHQSBKDKHPR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|