About tert-butyl 4-[(1R)-1,2-dihydroxyethyl]-4-hydroxypiperidine-1-carboxylate
tert-butyl 4-[(1R)-1,2-dihydroxyethyl]-4-hydroxypiperidine-1-carboxylate (PubChem CID 162402915) has the molecular formula C12H23NO5
and a molecular weight of 261.32 g/mol. Its IUPAC name is tert-butyl 4-[(1R)-1,2-dihydroxyethyl]-4-hydroxypiperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[(1R)-1,2-dihydroxyethyl]-4-hydroxypiperidine-1-carboxylate |
| PubChem CID | 162402915 |
| Molecular Formula | C12H23NO5 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | tert-butyl 4-[(1R)-1,2-dihydroxyethyl]-4-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)([C@H](O)CO)CC1 |
| InChI | InChI=1S/C12H23NO5/c1-11(2,3)18-10(16)13-6-4-12(17,5-7-13)9(15)8-14/h9,14-15,17H,4-8H2,1-3H3/t9-/m1/s1 |
| InChIKey | JEUDJPVDUWYAEM-SECBINFHSA-N |
| XLogP | 0.10 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-[(1R)-1,2-dihydroxyethyl]-4-hydroxypiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[(1R)-1,2-dihydroxyethyl]-4-hydroxypiperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[(1R)-1,2-dihydroxyethyl]-4-hydroxypiperidine-1-carboxylate (CID 162402915) is tert-butyl 4-[(1R)-1,2-dihydroxyethyl]-4-hydroxypiperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[(1R)-1,2-dihydroxyethyl]-4-hydroxypiperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[(1R)-1,2-dihydroxyethyl]-4-hydroxypiperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(O)([C@H](O)CO)CC1.
What is the InChIKey of tert-butyl 4-[(1R)-1,2-dihydroxyethyl]-4-hydroxypiperidine-1-carboxylate?
The InChIKey is JEUDJPVDUWYAEM-SECBINFHSA-N. The full InChI is InChI=1S/C12H23NO5/c1-11(2,3)18-10(16)13-6-4-12(17,5-7-13)9(15)8-14/h9,14-15,17H,4-8H2,1-3H3/t9-/m1/s1.
What are the key properties of tert-butyl 4-[(1R)-1,2-dihydroxyethyl]-4-hydroxypiperidine-1-carboxylate?
tert-butyl 4-[(1R)-1,2-dihydroxyethyl]-4-hydroxypiperidine-1-carboxylate has a molecular weight of 261.32 g/mol, XLogP of 0.10, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[(1R)-1,2-dihydroxyethyl]-4-hydroxypiperidine-1-carboxylate is sourced from PubChem (CID 162402915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).