C8H16O3 — CID 162402916
(2R,3S)-3-methylhept-6-ene-1,2,3-triol (PubChem CID 162402916) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (2R,3S)-3-methylhept-6-ene-1,2,3-triol.
| Compound Name | (2R,3S)-3-methylhept-6-ene-1,2,3-triol |
|---|---|
| PubChem CID | 162402916 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (2R,3S)-3-methylhept-6-ene-1,2,3-triol |
| SMILES | C=CCC[C@](C)(O)[C@H](O)CO |
| InChI | InChI=1S/C8H16O3/c1-3-4-5-8(2,11)7(10)6-9/h3,7,9-11H,1,4-6H2,2H3/t7-,8+/m1/s1 |
| InChIKey | IPLLOHOJWFPMCD-SFYZADRCSA-N |
| XLogP | 0.06 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|