C28H29NO2S — CID 162402963
2-[(E,1Z)-1-(3-butyl-1,3-benzothiazol-2-ylidene)oct-2-en-4-ylidene]indene-1,3-dione (PubChem CID 162402963) has the molecular formula C28H29NO2S and a molecular weight of 443.61 g/mol. Its IUPAC name is 2-[(E,1Z)-1-(3-butyl-1,3-benzothiazol-2-ylidene)oct-2-en-4-ylidene]indene-1,3-dione.
| Compound Name | 2-[(E,1Z)-1-(3-butyl-1,3-benzothiazol-2-ylidene)oct-2-en-4-ylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 162402963 |
| Molecular Formula | C28H29NO2S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 2-[(E,1Z)-1-(3-butyl-1,3-benzothiazol-2-ylidene)oct-2-en-4-ylidene]indene-1,3-dione |
| SMILES | CCCCC(/C=C/C=C1\Sc2ccccc2N1CCCC)=C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H29NO2S/c1-3-5-12-20(26-27(30)21-14-7-8-15-22(21)28(26)31)13-11-18-25-29(19-6-4-2)23-16-9-10-17-24(23)32-25/h7-11,13-18H,3-6,12,19H2,1-2H3/b13-11+,25-18- |
| InChIKey | AFQMSRVIARSOKA-JQZSRPDUSA-N |
| XLogP | 7.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|