C17H18BrNO5 — CID 162403000
dimethyl (3aR,9R,9aS)-9-bromo-2-methyl-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate (PubChem CID 162403000) has the molecular formula C17H18BrNO5 and a molecular weight of 396.24 g/mol. Its IUPAC name is dimethyl (3aR,9R,9aS)-9-bromo-2-methyl-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate.
| Compound Name | dimethyl (3aR,9R,9aS)-9-bromo-2-methyl-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate |
|---|---|
| PubChem CID | 162403000 |
| Molecular Formula | C17H18BrNO5 |
| Molecular Weight | 396.24 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | dimethyl (3aR,9R,9aS)-9-bromo-2-methyl-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)c2ccccc2[C@H](Br)[C@@H]2CN(C)C(=O)[C@H]21 |
| InChI | InChI=1S/C17H18BrNO5/c1-19-8-10-12(14(19)20)17(15(21)23-2,16(22)24-3)11-7-5-4-6-9(11)13(10)18/h4-7,10,12-13H,8H2,1-3H3/t10-,12+,13+/m1/s1 |
| InChIKey | GWPVEEKGEZYQOH-WXHSDQCUSA-N |
| XLogP | 1.42 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|