About (3R)-6-chloro-3-fluoro-3,4-dihydro-2H-chromene
(3R)-6-chloro-3-fluoro-3,4-dihydro-2H-chromene (PubChem CID 162403028) has the molecular formula C9H8ClFO
and a molecular weight of 186.61 g/mol. Its IUPAC name is (3R)-6-chloro-3-fluoro-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | (3R)-6-chloro-3-fluoro-3,4-dihydro-2H-chromene |
| PubChem CID | 162403028 |
| Molecular Formula | C9H8ClFO |
| Molecular Weight | 186.61 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | (3R)-6-chloro-3-fluoro-3,4-dihydro-2H-chromene |
| SMILES | F[C@H]1COc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C9H8ClFO/c10-7-1-2-9-6(3-7)4-8(11)5-12-9/h1-3,8H,4-5H2/t8-/m1/s1 |
| InChIKey | AADLTXACAKRNGA-MRVPVSSYSA-N |
| XLogP | 2.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.61 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-6-chloro-3-fluoro-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-6-chloro-3-fluoro-3,4-dihydro-2H-chromene?
The IUPAC name of (3R)-6-chloro-3-fluoro-3,4-dihydro-2H-chromene (CID 162403028) is (3R)-6-chloro-3-fluoro-3,4-dihydro-2H-chromene.
What is the SMILES notation for (3R)-6-chloro-3-fluoro-3,4-dihydro-2H-chromene?
The canonical SMILES for (3R)-6-chloro-3-fluoro-3,4-dihydro-2H-chromene is F[C@H]1COc2ccc(Cl)cc2C1.
What is the InChIKey of (3R)-6-chloro-3-fluoro-3,4-dihydro-2H-chromene?
The InChIKey is AADLTXACAKRNGA-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H8ClFO/c10-7-1-2-9-6(3-7)4-8(11)5-12-9/h1-3,8H,4-5H2/t8-/m1/s1.
What are the key properties of (3R)-6-chloro-3-fluoro-3,4-dihydro-2H-chromene?
(3R)-6-chloro-3-fluoro-3,4-dihydro-2H-chromene has a molecular weight of 186.61 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-6-chloro-3-fluoro-3,4-dihydro-2H-chromene is sourced from PubChem (CID 162403028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).