C9H9F3N4 — CID 162403043
5,7-dimethyl-6-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 162403043) has the molecular formula C9H9F3N4 and a molecular weight of 230.19 g/mol. Its IUPAC name is 5,7-dimethyl-6-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 5,7-dimethyl-6-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 162403043 |
| Molecular Formula | C9H9F3N4 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 5,7-dimethyl-6-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1nc2ncnn2c(C)c1CC(F)(F)F |
| InChI | InChI=1S/C9H9F3N4/c1-5-7(3-9(10,11)12)6(2)16-8(15-5)13-4-14-16/h4H,3H2,1-2H3 |
| InChIKey | HIGLAAFUGNJDBI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |