C18H37NO3Si — CID 162403149
tert-butyl (2S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrrolidine-1-carboxylate (PubChem CID 162403149) has the molecular formula C18H37NO3Si and a molecular weight of 343.58 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 162403149 |
| Molecular Formula | C18H37NO3Si |
| Molecular Weight | 343.58 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | tert-butyl (2S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H37NO3Si/c1-17(2,3)22-16(20)19-13-9-11-15(19)12-10-14-21-23(7,8)18(4,5)6/h15H,9-14H2,1-8H3/t15-/m0/s1 |
| InChIKey | KHLZRYJXVUEULE-HNNXBMFYSA-N |
| XLogP | 5.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.58 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|