About (5S,6R)-5,6-bis(but-3-enyl)bicyclo[2.2.1]hept-2-en-7-ol
(5S,6R)-5,6-bis(but-3-enyl)bicyclo[2.2.1]hept-2-en-7-ol (PubChem CID 162403245) has the molecular formula C15H22O
and a molecular weight of 218.34 g/mol. Its IUPAC name is (5S,6R)-5,6-bis(but-3-enyl)bicyclo[2.2.1]hept-2-en-7-ol.
Molecular Properties
| Compound Name | (5S,6R)-5,6-bis(but-3-enyl)bicyclo[2.2.1]hept-2-en-7-ol |
| PubChem CID | 162403245 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (5S,6R)-5,6-bis(but-3-enyl)bicyclo[2.2.1]hept-2-en-7-ol |
| SMILES | C=CCC[C@@H]1C2C=CC(C2O)[C@@H]1CCC=C |
| InChI | InChI=1S/C15H22O/c1-3-5-7-11-12(8-6-4-2)14-10-9-13(11)15(14)16/h3-4,9-16H,1-2,5-8H2/t11-,12+,13?,14?,15? |
| InChIKey | MUOQVIDLYKCXRV-HONBEQNRSA-N |
| XLogP | 3.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5S,6R)-5,6-bis(but-3-enyl)bicyclo[2.2.1]hept-2-en-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,6R)-5,6-bis(but-3-enyl)bicyclo[2.2.1]hept-2-en-7-ol?
The IUPAC name of (5S,6R)-5,6-bis(but-3-enyl)bicyclo[2.2.1]hept-2-en-7-ol (CID 162403245) is (5S,6R)-5,6-bis(but-3-enyl)bicyclo[2.2.1]hept-2-en-7-ol.
What is the SMILES notation for (5S,6R)-5,6-bis(but-3-enyl)bicyclo[2.2.1]hept-2-en-7-ol?
The canonical SMILES for (5S,6R)-5,6-bis(but-3-enyl)bicyclo[2.2.1]hept-2-en-7-ol is C=CCC[C@@H]1C2C=CC(C2O)[C@@H]1CCC=C.
What is the InChIKey of (5S,6R)-5,6-bis(but-3-enyl)bicyclo[2.2.1]hept-2-en-7-ol?
The InChIKey is MUOQVIDLYKCXRV-HONBEQNRSA-N. The full InChI is InChI=1S/C15H22O/c1-3-5-7-11-12(8-6-4-2)14-10-9-13(11)15(14)16/h3-4,9-16H,1-2,5-8H2/t11-,12+,13?,14?,15?.
What are the key properties of (5S,6R)-5,6-bis(but-3-enyl)bicyclo[2.2.1]hept-2-en-7-ol?
(5S,6R)-5,6-bis(but-3-enyl)bicyclo[2.2.1]hept-2-en-7-ol has a molecular weight of 218.34 g/mol, XLogP of 3.33, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,6R)-5,6-bis(but-3-enyl)bicyclo[2.2.1]hept-2-en-7-ol is sourced from PubChem (CID 162403245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).