C13H18O — CID 162403366
(4aS,4bR,8aR,9aS)-4,4a,4b,5,6,8a,9,9a-octahydro-3H-fluoren-9-ol (PubChem CID 162403366) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is (4aS,4bR,8aR,9aS)-4,4a,4b,5,6,8a,9,9a-octahydro-3H-fluoren-9-ol.
| Compound Name | (4aS,4bR,8aR,9aS)-4,4a,4b,5,6,8a,9,9a-octahydro-3H-fluoren-9-ol |
|---|---|
| PubChem CID | 162403366 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (4aS,4bR,8aR,9aS)-4,4a,4b,5,6,8a,9,9a-octahydro-3H-fluoren-9-ol |
| SMILES | OC1[C@H]2C=CCC[C@H]2[C@H]2CCC=C[C@@H]12 |
| InChI | InChI=1S/C13H18O/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h3-4,7-14H,1-2,5-6H2/t9-,10+,11-,12+,13? |
| InChIKey | RZXOWLJLBNADKV-HTYKTIJTSA-N |
| XLogP | 2.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|