C32H46O4Si — CID 162403379
tert-butyl-[[(2R,4S,5S,8S,9S)-9-ethenyl-8-(methoxymethoxymethyl)-4,8-dimethyl-1-oxaspiro[4.4]nonan-2-yl]methoxy]-diphenylsilane (PubChem CID 162403379) has the molecular formula C32H46O4Si and a molecular weight of 522.80 g/mol. Its IUPAC name is tert-butyl-[[(2R,4S,5S,8S,9S)-9-ethenyl-8-(methoxymethoxymethyl)-4,8-dimethyl-1-oxaspiro[4.4]nonan-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2R,4S,5S,8S,9S)-9-ethenyl-8-(methoxymethoxymethyl)-4,8-dimethyl-1-oxaspiro[4.4]nonan-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 162403379 |
| Molecular Formula | C32H46O4Si |
| Molecular Weight | 522.80 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | tert-butyl-[[(2R,4S,5S,8S,9S)-9-ethenyl-8-(methoxymethoxymethyl)-4,8-dimethyl-1-oxaspiro[4.4]nonan-2-yl]methoxy]-diphenylsilane |
| SMILES | C=C[C@H]1[C@@](C)(COCOC)CC[C@@]12O[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@@H]2C |
| InChI | InChI=1S/C32H46O4Si/c1-8-29-31(6,23-34-24-33-7)19-20-32(29)25(2)21-26(36-32)22-35-37(30(3,4)5,27-15-11-9-12-16-27)28-17-13-10-14-18-28/h8-18,25-26,29H,1,19-24H2,2-7H3/t25-,26+,29-,31+,32-/m0/s1 |
| InChIKey | PHOIWAGCAMHYBJ-NEGUADISSA-N |
| XLogP | 5.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.80 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|