About ethyl (4R)-4-[(1R)-1-(1-benzothiophen-2-yl)-1-hydroxyethyl]-2,2-difluorohex-5-enoate
ethyl (4R)-4-[(1R)-1-(1-benzothiophen-2-yl)-1-hydroxyethyl]-2,2-difluorohex-5-enoate (PubChem CID 162403564) has the molecular formula C18H20F2O3S
and a molecular weight of 354.42 g/mol. Its IUPAC name is ethyl (4R)-4-[(1R)-1-(1-benzothiophen-2-yl)-1-hydroxyethyl]-2,2-difluorohex-5-enoate.
Molecular Properties
| Compound Name | ethyl (4R)-4-[(1R)-1-(1-benzothiophen-2-yl)-1-hydroxyethyl]-2,2-difluorohex-5-enoate |
| PubChem CID | 162403564 |
| Molecular Formula | C18H20F2O3S |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | ethyl (4R)-4-[(1R)-1-(1-benzothiophen-2-yl)-1-hydroxyethyl]-2,2-difluorohex-5-enoate |
| SMILES | C=C[C@@H](CC(F)(F)C(=O)OCC)[C@@](C)(O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C18H20F2O3S/c1-4-13(11-18(19,20)16(21)23-5-2)17(3,22)15-10-12-8-6-7-9-14(12)24-15/h4,6-10,13,22H,1,5,11H2,2-3H3/t13-,17+/m0/s1 |
| InChIKey | OVSSOKBWZJRZKU-SUMWQHHRSA-N |
| XLogP | 4.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (4R)-4-[(1R)-1-(1-benzothiophen-2-yl)-1-hydroxyethyl]-2,2-difluorohex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4R)-4-[(1R)-1-(1-benzothiophen-2-yl)-1-hydroxyethyl]-2,2-difluorohex-5-enoate?
The IUPAC name of ethyl (4R)-4-[(1R)-1-(1-benzothiophen-2-yl)-1-hydroxyethyl]-2,2-difluorohex-5-enoate (CID 162403564) is ethyl (4R)-4-[(1R)-1-(1-benzothiophen-2-yl)-1-hydroxyethyl]-2,2-difluorohex-5-enoate.
What is the SMILES notation for ethyl (4R)-4-[(1R)-1-(1-benzothiophen-2-yl)-1-hydroxyethyl]-2,2-difluorohex-5-enoate?
The canonical SMILES for ethyl (4R)-4-[(1R)-1-(1-benzothiophen-2-yl)-1-hydroxyethyl]-2,2-difluorohex-5-enoate is C=C[C@@H](CC(F)(F)C(=O)OCC)[C@@](C)(O)c1cc2ccccc2s1.
What is the InChIKey of ethyl (4R)-4-[(1R)-1-(1-benzothiophen-2-yl)-1-hydroxyethyl]-2,2-difluorohex-5-enoate?
The InChIKey is OVSSOKBWZJRZKU-SUMWQHHRSA-N. The full InChI is InChI=1S/C18H20F2O3S/c1-4-13(11-18(19,20)16(21)23-5-2)17(3,22)15-10-12-8-6-7-9-14(12)24-15/h4,6-10,13,22H,1,5,11H2,2-3H3/t13-,17+/m0/s1.
What are the key properties of ethyl (4R)-4-[(1R)-1-(1-benzothiophen-2-yl)-1-hydroxyethyl]-2,2-difluorohex-5-enoate?
ethyl (4R)-4-[(1R)-1-(1-benzothiophen-2-yl)-1-hydroxyethyl]-2,2-difluorohex-5-enoate has a molecular weight of 354.42 g/mol, XLogP of 4.50, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4R)-4-[(1R)-1-(1-benzothiophen-2-yl)-1-hydroxyethyl]-2,2-difluorohex-5-enoate is sourced from PubChem (CID 162403564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).