C13H18O — CID 162403579
(1R,3S,3aS,7aR)-1,3-bis(ethenyl)-2,3,3a,4,7,7a-hexahydro-1H-inden-2-ol (PubChem CID 162403579) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is (1R,3S,3aS,7aR)-1,3-bis(ethenyl)-2,3,3a,4,7,7a-hexahydro-1H-inden-2-ol.
| Compound Name | (1R,3S,3aS,7aR)-1,3-bis(ethenyl)-2,3,3a,4,7,7a-hexahydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 162403579 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (1R,3S,3aS,7aR)-1,3-bis(ethenyl)-2,3,3a,4,7,7a-hexahydro-1H-inden-2-ol |
| SMILES | C=C[C@@H]1C(O)[C@H](C=C)[C@@H]2CC=CC[C@@H]21 |
| InChI | InChI=1S/C13H18O/c1-3-9-11-7-5-6-8-12(11)10(4-2)13(9)14/h3-6,9-14H,1-2,7-8H2/t9-,10+,11+,12-,13? |
| InChIKey | ZCWFSUVRRITWIP-IQYBISDWSA-N |
| XLogP | 2.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|