C16H22O2 — CID 162403600
(2S,3S,3aS,5aS,6S,7S,8aS,8bR)-2,7-bis(ethenyl)-1,2,3,3a,5a,6,7,8,8a,8b-decahydro-as-indacene-3,6-diol (PubChem CID 162403600) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (2S,3S,3aS,5aS,6S,7S,8aS,8bR)-2,7-bis(ethenyl)-1,2,3,3a,5a,6,7,8,8a,8b-decahydro-as-indacene-3,6-diol.
| Compound Name | (2S,3S,3aS,5aS,6S,7S,8aS,8bR)-2,7-bis(ethenyl)-1,2,3,3a,5a,6,7,8,8a,8b-decahydro-as-indacene-3,6-diol |
|---|---|
| PubChem CID | 162403600 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (2S,3S,3aS,5aS,6S,7S,8aS,8bR)-2,7-bis(ethenyl)-1,2,3,3a,5a,6,7,8,8a,8b-decahydro-as-indacene-3,6-diol |
| SMILES | C=C[C@@H]1C[C@@H]2[C@H](C=C[C@@H]3[C@@H](O)[C@H](C=C)C[C@@H]32)[C@H]1O |
| InChI | InChI=1S/C16H22O2/c1-3-9-7-13-11(15(9)17)5-6-12-14(13)8-10(4-2)16(12)18/h3-6,9-18H,1-2,7-8H2/t9-,10-,11+,12+,13-,14+,15+,16+/m1/s1 |
| InChIKey | ZTRJVVUVFBKDEW-MEYOTJAKSA-N |
| XLogP | 2.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|