C11H19NO — CID 162403640
(4R,10aS)-4-methyl-2,3,4,6,7,8,10,10a-octahydro-1H-pyrido[1,2-a]azepin-9-one (PubChem CID 162403640) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (4R,10aS)-4-methyl-2,3,4,6,7,8,10,10a-octahydro-1H-pyrido[1,2-a]azepin-9-one.
| Compound Name | (4R,10aS)-4-methyl-2,3,4,6,7,8,10,10a-octahydro-1H-pyrido[1,2-a]azepin-9-one |
|---|---|
| PubChem CID | 162403640 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (4R,10aS)-4-methyl-2,3,4,6,7,8,10,10a-octahydro-1H-pyrido[1,2-a]azepin-9-one |
| SMILES | C[C@@H]1CCC[C@H]2CC(=O)CCCN21 |
| InChI | InChI=1S/C11H19NO/c1-9-4-2-5-10-8-11(13)6-3-7-12(9)10/h9-10H,2-8H2,1H3/t9-,10+/m1/s1 |
| InChIKey | SKFUHTZZJQSSST-ZJUUUORDSA-N |
| XLogP | 1.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |