C23H25NO7S — CID 162403673
dimethyl (5R)-5-methyl-2-(4-methylphenyl)sulfonyl-3-oxo-4,5-dihydro-1H-2-benzazocine-6,6-dicarboxylate (PubChem CID 162403673) has the molecular formula C23H25NO7S and a molecular weight of 459.52 g/mol. Its IUPAC name is dimethyl (5R)-5-methyl-2-(4-methylphenyl)sulfonyl-3-oxo-4,5-dihydro-1H-2-benzazocine-6,6-dicarboxylate.
| Compound Name | dimethyl (5R)-5-methyl-2-(4-methylphenyl)sulfonyl-3-oxo-4,5-dihydro-1H-2-benzazocine-6,6-dicarboxylate |
|---|---|
| PubChem CID | 162403673 |
| Molecular Formula | C23H25NO7S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | dimethyl (5R)-5-methyl-2-(4-methylphenyl)sulfonyl-3-oxo-4,5-dihydro-1H-2-benzazocine-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)c2ccccc2CN(S(=O)(=O)c2ccc(C)cc2)C(=O)C[C@H]1C |
| InChI | InChI=1S/C23H25NO7S/c1-15-9-11-18(12-10-15)32(28,29)24-14-17-7-5-6-8-19(17)23(21(26)30-3,22(27)31-4)16(2)13-20(24)25/h5-12,16H,13-14H2,1-4H3/t16-/m1/s1 |
| InChIKey | GYMBLIGHBJKBLH-MRXNPFEDSA-N |
| XLogP | 2.34 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|