About ditert-butyl 1-(4-methylphenyl)sulfonyl-7-oxo-5-[(E)-prop-1-enyl]azepane-4,4-dicarboxylate
ditert-butyl 1-(4-methylphenyl)sulfonyl-7-oxo-5-[(E)-prop-1-enyl]azepane-4,4-dicarboxylate (PubChem CID 162403674) has the molecular formula C26H37NO7S
and a molecular weight of 507.65 g/mol. Its IUPAC name is ditert-butyl 1-(4-methylphenyl)sulfonyl-7-oxo-5-[(E)-prop-1-enyl]azepane-4,4-dicarboxylate.
Molecular Properties
| Compound Name | ditert-butyl 1-(4-methylphenyl)sulfonyl-7-oxo-5-[(E)-prop-1-enyl]azepane-4,4-dicarboxylate |
| PubChem CID | 162403674 |
| Molecular Formula | C26H37NO7S |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | ditert-butyl 1-(4-methylphenyl)sulfonyl-7-oxo-5-[(E)-prop-1-enyl]azepane-4,4-dicarboxylate |
| SMILES | C/C=C/C1CC(=O)N(S(=O)(=O)c2ccc(C)cc2)CCC1(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H37NO7S/c1-9-10-19-17-21(28)27(35(31,32)20-13-11-18(2)12-14-20)16-15-26(19,22(29)33-24(3,4)5)23(30)34-25(6,7)8/h9-14,19H,15-17H2,1-8H3/b10-9+ |
| InChIKey | ZRNWFZOOWSGKHO-MDZDMXLPSA-N |
| XLogP | 4.17 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 1-(4-methylphenyl)sulfonyl-7-oxo-5-[(E)-prop-1-enyl]azepane-4,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 1-(4-methylphenyl)sulfonyl-7-oxo-5-[(E)-prop-1-enyl]azepane-4,4-dicarboxylate?
The IUPAC name of ditert-butyl 1-(4-methylphenyl)sulfonyl-7-oxo-5-[(E)-prop-1-enyl]azepane-4,4-dicarboxylate (CID 162403674) is ditert-butyl 1-(4-methylphenyl)sulfonyl-7-oxo-5-[(E)-prop-1-enyl]azepane-4,4-dicarboxylate.
What is the SMILES notation for ditert-butyl 1-(4-methylphenyl)sulfonyl-7-oxo-5-[(E)-prop-1-enyl]azepane-4,4-dicarboxylate?
The canonical SMILES for ditert-butyl 1-(4-methylphenyl)sulfonyl-7-oxo-5-[(E)-prop-1-enyl]azepane-4,4-dicarboxylate is C/C=C/C1CC(=O)N(S(=O)(=O)c2ccc(C)cc2)CCC1(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl 1-(4-methylphenyl)sulfonyl-7-oxo-5-[(E)-prop-1-enyl]azepane-4,4-dicarboxylate?
The InChIKey is ZRNWFZOOWSGKHO-MDZDMXLPSA-N. The full InChI is InChI=1S/C26H37NO7S/c1-9-10-19-17-21(28)27(35(31,32)20-13-11-18(2)12-14-20)16-15-26(19,22(29)33-24(3,4)5)23(30)34-25(6,7)8/h9-14,19H,15-17H2,1-8H3/b10-9+.
What are the key properties of ditert-butyl 1-(4-methylphenyl)sulfonyl-7-oxo-5-[(E)-prop-1-enyl]azepane-4,4-dicarboxylate?
ditert-butyl 1-(4-methylphenyl)sulfonyl-7-oxo-5-[(E)-prop-1-enyl]azepane-4,4-dicarboxylate has a molecular weight of 507.65 g/mol, XLogP of 4.17, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 1-(4-methylphenyl)sulfonyl-7-oxo-5-[(E)-prop-1-enyl]azepane-4,4-dicarboxylate is sourced from PubChem (CID 162403674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).