About ditert-butyl (5R)-5-methyl-1-(4-methylphenyl)sulfonyl-7-oxoazepane-4,4-dicarboxylate
ditert-butyl (5R)-5-methyl-1-(4-methylphenyl)sulfonyl-7-oxoazepane-4,4-dicarboxylate (PubChem CID 162403676) has the molecular formula C24H35NO7S
and a molecular weight of 481.61 g/mol. Its IUPAC name is ditert-butyl (5R)-5-methyl-1-(4-methylphenyl)sulfonyl-7-oxoazepane-4,4-dicarboxylate.
Molecular Properties
| Compound Name | ditert-butyl (5R)-5-methyl-1-(4-methylphenyl)sulfonyl-7-oxoazepane-4,4-dicarboxylate |
| PubChem CID | 162403676 |
| Molecular Formula | C24H35NO7S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | ditert-butyl (5R)-5-methyl-1-(4-methylphenyl)sulfonyl-7-oxoazepane-4,4-dicarboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)[C@H](C)CC2=O)cc1 |
| InChI | InChI=1S/C24H35NO7S/c1-16-9-11-18(12-10-16)33(29,30)25-14-13-24(17(2)15-19(25)26,20(27)31-22(3,4)5)21(28)32-23(6,7)8/h9-12,17H,13-15H2,1-8H3/t17-/m1/s1 |
| InChIKey | CWUNAMGAOLVMJR-QGZVFWFLSA-N |
| XLogP | 3.61 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl (5R)-5-methyl-1-(4-methylphenyl)sulfonyl-7-oxoazepane-4,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl (5R)-5-methyl-1-(4-methylphenyl)sulfonyl-7-oxoazepane-4,4-dicarboxylate?
The IUPAC name of ditert-butyl (5R)-5-methyl-1-(4-methylphenyl)sulfonyl-7-oxoazepane-4,4-dicarboxylate (CID 162403676) is ditert-butyl (5R)-5-methyl-1-(4-methylphenyl)sulfonyl-7-oxoazepane-4,4-dicarboxylate.
What is the SMILES notation for ditert-butyl (5R)-5-methyl-1-(4-methylphenyl)sulfonyl-7-oxoazepane-4,4-dicarboxylate?
The canonical SMILES for ditert-butyl (5R)-5-methyl-1-(4-methylphenyl)sulfonyl-7-oxoazepane-4,4-dicarboxylate is Cc1ccc(S(=O)(=O)N2CCC(C(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)[C@H](C)CC2=O)cc1.
What is the InChIKey of ditert-butyl (5R)-5-methyl-1-(4-methylphenyl)sulfonyl-7-oxoazepane-4,4-dicarboxylate?
The InChIKey is CWUNAMGAOLVMJR-QGZVFWFLSA-N. The full InChI is InChI=1S/C24H35NO7S/c1-16-9-11-18(12-10-16)33(29,30)25-14-13-24(17(2)15-19(25)26,20(27)31-22(3,4)5)21(28)32-23(6,7)8/h9-12,17H,13-15H2,1-8H3/t17-/m1/s1.
What are the key properties of ditert-butyl (5R)-5-methyl-1-(4-methylphenyl)sulfonyl-7-oxoazepane-4,4-dicarboxylate?
ditert-butyl (5R)-5-methyl-1-(4-methylphenyl)sulfonyl-7-oxoazepane-4,4-dicarboxylate has a molecular weight of 481.61 g/mol, XLogP of 3.61, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl (5R)-5-methyl-1-(4-methylphenyl)sulfonyl-7-oxoazepane-4,4-dicarboxylate is sourced from PubChem (CID 162403676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).