C18H23FO3 — CID 162403737
(3R)-4-(4,4-dimethyl-5-oxooxolan-2-yl)-3-(4-fluorophenyl)-4-methylpentanal (PubChem CID 162403737) has the molecular formula C18H23FO3 and a molecular weight of 306.38 g/mol. Its IUPAC name is (3R)-4-(4,4-dimethyl-5-oxooxolan-2-yl)-3-(4-fluorophenyl)-4-methylpentanal.
| Compound Name | (3R)-4-(4,4-dimethyl-5-oxooxolan-2-yl)-3-(4-fluorophenyl)-4-methylpentanal |
|---|---|
| PubChem CID | 162403737 |
| Molecular Formula | C18H23FO3 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (3R)-4-(4,4-dimethyl-5-oxooxolan-2-yl)-3-(4-fluorophenyl)-4-methylpentanal |
| SMILES | CC1(C)CC(C(C)(C)[C@H](CC=O)c2ccc(F)cc2)OC1=O |
| InChI | InChI=1S/C18H23FO3/c1-17(2)11-15(22-16(17)21)18(3,4)14(9-10-20)12-5-7-13(19)8-6-12/h5-8,10,14-15H,9,11H2,1-4H3/t14-,15?/m1/s1 |
| InChIKey | MLVVOVJDXGEYIR-GICMACPYSA-N |
| XLogP | 3.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|