C15H22O2 — CID 162403814
(2R,5Z,9S)-13,13-dimethoxytricyclo[8.2.1.02,9]trideca-5,11-diene (PubChem CID 162403814) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (2R,5Z,9S)-13,13-dimethoxytricyclo[8.2.1.02,9]trideca-5,11-diene.
| Compound Name | (2R,5Z,9S)-13,13-dimethoxytricyclo[8.2.1.02,9]trideca-5,11-diene |
|---|---|
| PubChem CID | 162403814 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (2R,5Z,9S)-13,13-dimethoxytricyclo[8.2.1.02,9]trideca-5,11-diene |
| SMILES | COC1(OC)C2C=CC1[C@@H]1CC/C=C\CC[C@H]21 |
| InChI | InChI=1S/C15H22O2/c1-16-15(17-2)13-9-10-14(15)12-8-6-4-3-5-7-11(12)13/h3-4,9-14H,5-8H2,1-2H3/b4-3-/t11-,12+,13?,14? |
| InChIKey | ZPZPJZUVCQOQMD-UGEREAELSA-N |
| XLogP | 3.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|