C24H30N2O5 — CID 162403873
[benzyl-(2-phenylacetyl)amino] 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (PubChem CID 162403873) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is [benzyl-(2-phenylacetyl)amino] 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate.
| Compound Name | [benzyl-(2-phenylacetyl)amino] 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 162403873 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | [benzyl-(2-phenylacetyl)amino] 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| SMILES | CC(C(=O)ON(Cc1ccccc1)C(=O)Cc1ccccc1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H30N2O5/c1-18(25(5)23(29)30-24(2,3)4)22(28)31-26(17-20-14-10-7-11-15-20)21(27)16-19-12-8-6-9-13-19/h6-15,18H,16-17H2,1-5H3 |
| InChIKey | HFZJNQODZHNKRW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|