C16H15FOS — CID 162403928
S-[(1R,2R)-2-fluoro-1,2-diphenylethyl] ethanethioate (PubChem CID 162403928) has the molecular formula C16H15FOS and a molecular weight of 274.36 g/mol. Its IUPAC name is S-[(1R,2R)-2-fluoro-1,2-diphenylethyl] ethanethioate.
| Compound Name | S-[(1R,2R)-2-fluoro-1,2-diphenylethyl] ethanethioate |
|---|---|
| PubChem CID | 162403928 |
| Molecular Formula | C16H15FOS |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | S-[(1R,2R)-2-fluoro-1,2-diphenylethyl] ethanethioate |
| SMILES | CC(=O)S[C@H](c1ccccc1)[C@H](F)c1ccccc1 |
| InChI | InChI=1S/C16H15FOS/c1-12(18)19-16(14-10-6-3-7-11-14)15(17)13-8-4-2-5-9-13/h2-11,15-16H,1H3/t15-,16-/m1/s1 |
| InChIKey | MUALYNGDTPUCKI-HZPDHXFCSA-N |
| XLogP | 4.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|