C19H36N6O2+2 — CID 162403943
4,6-bis(4-methylmorpholin-4-ium-4-yl)-N,N-di(propan-2-yl)-1,3,5-triazin-2-amine (PubChem CID 162403943) has the molecular formula C19H36N6O2+2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 4,6-bis(4-methylmorpholin-4-ium-4-yl)-N,N-di(propan-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis(4-methylmorpholin-4-ium-4-yl)-N,N-di(propan-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 162403943 |
| Molecular Formula | C19H36N6O2+2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 4,6-bis(4-methylmorpholin-4-ium-4-yl)-N,N-di(propan-2-yl)-1,3,5-triazin-2-amine |
| SMILES | CC(C)N(c1nc([N+]2(C)CCOCC2)nc([N+]2(C)CCOCC2)n1)C(C)C |
| InChI | InChI=1S/C19H36N6O2/c1-15(2)23(16(3)4)17-20-18(24(5)7-11-26-12-8-24)22-19(21-17)25(6)9-13-27-14-10-25/h15-16H,7-14H2,1-6H3/q+2 |
| InChIKey | CMYPCFAFSIQSQT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|