C28H25NO2 — CID 162403953
(1R,5S,6R)-6-ethyl-3-methyl-1,5-diphenylspiro[3-azabicyclo[3.1.0]hexane-2,2'-indene]-1',3'-dione (PubChem CID 162403953) has the molecular formula C28H25NO2 and a molecular weight of 407.51 g/mol. Its IUPAC name is (1R,5S,6R)-6-ethyl-3-methyl-1,5-diphenylspiro[3-azabicyclo[3.1.0]hexane-2,2'-indene]-1',3'-dione.
| Compound Name | (1R,5S,6R)-6-ethyl-3-methyl-1,5-diphenylspiro[3-azabicyclo[3.1.0]hexane-2,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 162403953 |
| Molecular Formula | C28H25NO2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (1R,5S,6R)-6-ethyl-3-methyl-1,5-diphenylspiro[3-azabicyclo[3.1.0]hexane-2,2'-indene]-1',3'-dione |
| SMILES | CC[C@@H]1[C@@]2(c3ccccc3)CN(C)C3(C(=O)c4ccccc4C3=O)[C@@]12c1ccccc1 |
| InChI | InChI=1S/C28H25NO2/c1-3-23-26(19-12-6-4-7-13-19)18-29(2)28(27(23,26)20-14-8-5-9-15-20)24(30)21-16-10-11-17-22(21)25(28)31/h4-17,23H,3,18H2,1-2H3/t23-,26+,27+/m1/s1 |
| InChIKey | DEFJEYOOPQPIDC-NPAAKHOSSA-N |
| XLogP | 4.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|