C28H44O11 — CID 162404549
[(1S,3R,13S,14S,15E)-13-hydroxy-3-(hydroxymethyl)-15-(2-methoxy-2-oxoethylidene)-12,12-dimethyl-5,9-dioxo-4,10,17-trioxabicyclo[11.3.1]heptadecan-14-yl] octanoate (PubChem CID 162404549) has the molecular formula C28H44O11 and a molecular weight of 556.65 g/mol. Its IUPAC name is [(1S,3R,13S,14S,15E)-13-hydroxy-3-(hydroxymethyl)-15-(2-methoxy-2-oxoethylidene)-12,12-dimethyl-5,9-dioxo-4,10,17-trioxabicyclo[11.3.1]heptadecan-14-yl] octanoate.
| Compound Name | [(1S,3R,13S,14S,15E)-13-hydroxy-3-(hydroxymethyl)-15-(2-methoxy-2-oxoethylidene)-12,12-dimethyl-5,9-dioxo-4,10,17-trioxabicyclo[11.3.1]heptadecan-14-yl] octanoate |
|---|---|
| PubChem CID | 162404549 |
| Molecular Formula | C28H44O11 |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | [(1S,3R,13S,14S,15E)-13-hydroxy-3-(hydroxymethyl)-15-(2-methoxy-2-oxoethylidene)-12,12-dimethyl-5,9-dioxo-4,10,17-trioxabicyclo[11.3.1]heptadecan-14-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H]1/C(=C/C(=O)OC)C[C@H]2C[C@H](CO)OC(=O)CCCC(=O)OCC(C)(C)[C@]1(O)O2 |
| InChI | InChI=1S/C28H44O11/c1-5-6-7-8-9-11-24(32)38-26-19(15-25(33)35-4)14-20-16-21(17-29)37-23(31)13-10-12-22(30)36-18-27(2,3)28(26,34)39-20/h15,20-21,26,29,34H,5-14,16-18H2,1-4H3/b19-15+/t20-,21+,26-,28+/m0/s1 |
| InChIKey | ZXPNTBZIOGIRNR-CBRXCOKOSA-N |
| XLogP | 2.88 |
| TPSA | 154.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|