C12H22F3NO — CID 162404610
N-(4-ethyloctyl)-2,2,2-trifluoroacetamide (PubChem CID 162404610) has the molecular formula C12H22F3NO and a molecular weight of 253.31 g/mol. Its IUPAC name is N-(4-ethyloctyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(4-ethyloctyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 162404610 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | N-(4-ethyloctyl)-2,2,2-trifluoroacetamide |
| SMILES | CCCCC(CC)CCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H22F3NO/c1-3-5-7-10(4-2)8-6-9-16-11(17)12(13,14)15/h10H,3-9H2,1-2H3,(H,16,17) |
| InChIKey | ODSXIBQPXVIEJJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|