C16H15F5O4 — CID 162404650
1-O-ethyl 5-O-methyl (3S)-2,2-difluoro-4-methylidene-3-[4-(trifluoromethyl)phenyl]pentanedioate (PubChem CID 162404650) has the molecular formula C16H15F5O4 and a molecular weight of 366.28 g/mol. Its IUPAC name is 1-O-ethyl 5-O-methyl (3S)-2,2-difluoro-4-methylidene-3-[4-(trifluoromethyl)phenyl]pentanedioate.
| Compound Name | 1-O-ethyl 5-O-methyl (3S)-2,2-difluoro-4-methylidene-3-[4-(trifluoromethyl)phenyl]pentanedioate |
|---|---|
| PubChem CID | 162404650 |
| Molecular Formula | C16H15F5O4 |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 1-O-ethyl 5-O-methyl (3S)-2,2-difluoro-4-methylidene-3-[4-(trifluoromethyl)phenyl]pentanedioate |
| SMILES | C=C(C(=O)OC)[C@H](c1ccc(C(F)(F)F)cc1)C(F)(F)C(=O)OCC |
| InChI | InChI=1S/C16H15F5O4/c1-4-25-14(23)15(17,18)12(9(2)13(22)24-3)10-5-7-11(8-6-10)16(19,20)21/h5-8,12H,2,4H2,1,3H3/t12-/m1/s1 |
| InChIKey | DSWHRJVUFFNBBB-GFCCVEGCSA-N |
| XLogP | 3.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|