About [6'-(methoxymethoxy)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl] trifluoromethanesulfonate
[6'-(methoxymethoxy)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl] trifluoromethanesulfonate (PubChem CID 162404669) has the molecular formula C23H17F3O7S
and a molecular weight of 494.44 g/mol. Its IUPAC name is [6'-(methoxymethoxy)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [6'-(methoxymethoxy)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl] trifluoromethanesulfonate |
| PubChem CID | 162404669 |
| Molecular Formula | C23H17F3O7S |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | [6'-(methoxymethoxy)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl] trifluoromethanesulfonate |
| SMILES | COCOc1ccc2c(c1)Oc1cc(OS(=O)(=O)C(F)(F)F)ccc1C21OCc2ccccc21 |
| InChI | InChI=1S/C23H17F3O7S/c1-29-13-30-15-6-8-18-20(10-15)32-21-11-16(33-34(27,28)23(24,25)26)7-9-19(21)22(18)17-5-3-2-4-14(17)12-31-22/h2-11H,12-13H2,1H3 |
| InChIKey | SGNPMHHWVFXHIT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [6'-(methoxymethoxy)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6'-(methoxymethoxy)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl] trifluoromethanesulfonate?
The IUPAC name of [6'-(methoxymethoxy)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl] trifluoromethanesulfonate (CID 162404669) is [6'-(methoxymethoxy)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl] trifluoromethanesulfonate.
What is the SMILES notation for [6'-(methoxymethoxy)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl] trifluoromethanesulfonate?
The canonical SMILES for [6'-(methoxymethoxy)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl] trifluoromethanesulfonate is COCOc1ccc2c(c1)Oc1cc(OS(=O)(=O)C(F)(F)F)ccc1C21OCc2ccccc21.
What is the InChIKey of [6'-(methoxymethoxy)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl] trifluoromethanesulfonate?
The InChIKey is SGNPMHHWVFXHIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17F3O7S/c1-29-13-30-15-6-8-18-20(10-15)32-21-11-16(33-34(27,28)23(24,25)26)7-9-19(21)22(18)17-5-3-2-4-14(17)12-31-22/h2-11H,12-13H2,1H3.
What are the key properties of [6'-(methoxymethoxy)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl] trifluoromethanesulfonate?
[6'-(methoxymethoxy)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl] trifluoromethanesulfonate has a molecular weight of 494.44 g/mol, XLogP of 4.83, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6'-(methoxymethoxy)spiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl] trifluoromethanesulfonate is sourced from PubChem (CID 162404669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).