C19H26NO+ — CID 162404699
(2S,13S)-13-but-2-enyl-13-azoniatetracyclo[7.7.0.01,6.02,13]hexadeca-8,10-dien-5-one (PubChem CID 162404699) has the molecular formula C19H26NO+ and a molecular weight of 284.42 g/mol. Its IUPAC name is (2S,13S)-13-but-2-enyl-13-azoniatetracyclo[7.7.0.01,6.02,13]hexadeca-8,10-dien-5-one.
| Compound Name | (2S,13S)-13-but-2-enyl-13-azoniatetracyclo[7.7.0.01,6.02,13]hexadeca-8,10-dien-5-one |
|---|---|
| PubChem CID | 162404699 |
| Molecular Formula | C19H26NO+ |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (2S,13S)-13-but-2-enyl-13-azoniatetracyclo[7.7.0.01,6.02,13]hexadeca-8,10-dien-5-one |
| SMILES | CC=CC[N@@+]12CC=CC3=CCC4C(=O)CC[C@H]1C34CCC2 |
| InChI | InChI=1S/C19H26NO/c1-2-3-12-20-13-4-6-15-7-8-16-17(21)9-10-18(20)19(15,16)11-5-14-20/h2-4,6-7,16,18H,5,8-14H2,1H3/q+1/t16?,18-,19?,20-/m0/s1 |
| InChIKey | NABLTFWCAYURME-YSNUMNBNSA-N |
| XLogP | 3.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|