C28H21F3NO3PS2 — CID 162404874
[triphenyl-(2-thiophen-3-yl-4-pyridinyl)-λ5-phosphanyl] trifluoromethanesulfonate (PubChem CID 162404874) has the molecular formula C28H21F3NO3PS2 and a molecular weight of 571.58 g/mol. Its IUPAC name is [triphenyl-(2-thiophen-3-yl-4-pyridinyl)-λ5-phosphanyl] trifluoromethanesulfonate.
| Compound Name | [triphenyl-(2-thiophen-3-yl-4-pyridinyl)-λ5-phosphanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162404874 |
| Molecular Formula | C28H21F3NO3PS2 |
| Molecular Weight | 571.58 g/mol |
| Exact Mass | 571.07 |
| IUPAC Name | [triphenyl-(2-thiophen-3-yl-4-pyridinyl)-λ5-phosphanyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OP(c1ccccc1)(c1ccccc1)(c1ccccc1)c1ccnc(-c2ccsc2)c1)C(F)(F)F |
| InChI | InChI=1S/C28H21F3NO3PS2/c29-28(30,31)38(33,34)35-36(23-10-4-1-5-11-23,24-12-6-2-7-13-24,25-14-8-3-9-15-25)26-16-18-32-27(20-26)22-17-19-37-21-22/h1-21H |
| InChIKey | NWKXGJMAEPDKLN-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.58 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|