C21H36O3Si — CID 162405018
(1S,5S,8S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-4,4,8-trimethyltricyclo[6.3.1.01,5]dodecane-2,12-dione (PubChem CID 162405018) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is (1S,5S,8S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-4,4,8-trimethyltricyclo[6.3.1.01,5]dodecane-2,12-dione.
| Compound Name | (1S,5S,8S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-4,4,8-trimethyltricyclo[6.3.1.01,5]dodecane-2,12-dione |
|---|---|
| PubChem CID | 162405018 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (1S,5S,8S,9R)-9-[tert-butyl(dimethyl)silyl]oxy-4,4,8-trimethyltricyclo[6.3.1.01,5]dodecane-2,12-dione |
| SMILES | CC1(C)CC(=O)[C@]23CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@](C)(CC[C@@H]12)C3=O |
| InChI | InChI=1S/C21H36O3Si/c1-18(2,3)25(7,8)24-16-10-12-21-14(19(4,5)13-15(21)22)9-11-20(16,6)17(21)23/h14,16H,9-13H2,1-8H3/t14-,16+,20-,21-/m0/s1 |
| InChIKey | JNBKRRCSEASPPI-LJQHDNKASA-N |
| XLogP | 5.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|