C24H42O3Si — CID 162405194
ethyl (5S,8E,10Z)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,7,7-trimethyldodeca-8,10-dien-3-ynoate (PubChem CID 162405194) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is ethyl (5S,8E,10Z)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,7,7-trimethyldodeca-8,10-dien-3-ynoate.
| Compound Name | ethyl (5S,8E,10Z)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,7,7-trimethyldodeca-8,10-dien-3-ynoate |
|---|---|
| PubChem CID | 162405194 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | ethyl (5S,8E,10Z)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,7,7-trimethyldodeca-8,10-dien-3-ynoate |
| SMILES | C/C=C\C=C\C(C)(C)C[C@@](C)(C#CCC(=O)OCC)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H42O3Si/c1-11-13-14-17-23(6,7)19-24(8,18-15-16-21(25)26-12-2)20-27-28(9,10)22(3,4)5/h11,13-14,17H,12,16,19-20H2,1-10H3/b13-11-,17-14+/t24-/m1/s1 |
| InChIKey | IXZPMLDFERSJPC-TVAPSCEOSA-N |
| XLogP | 6.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|