C12H26N4 — CID 162405389
N-butyl-3-pentyl-2,4-dihydro-1H-1,3,5-triazin-6-amine (PubChem CID 162405389) has the molecular formula C12H26N4 and a molecular weight of 226.37 g/mol. Its IUPAC name is N-butyl-3-pentyl-2,4-dihydro-1H-1,3,5-triazin-6-amine.
| Compound Name | N-butyl-3-pentyl-2,4-dihydro-1H-1,3,5-triazin-6-amine |
|---|---|
| PubChem CID | 162405389 |
| Molecular Formula | C12H26N4 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | N-butyl-3-pentyl-2,4-dihydro-1H-1,3,5-triazin-6-amine |
| SMILES | CCCCCN1CN=C(NCCCC)NC1 |
| InChI | InChI=1S/C12H26N4/c1-3-5-7-9-16-10-14-12(15-11-16)13-8-6-4-2/h3-11H2,1-2H3,(H2,13,14,15) |
| InChIKey | GXHOXMWYSRIUGR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|