About zinc;1,3-dimethyl-1,3-diazinan-2-one;bis(trifluoromethane)
zinc;1,3-dimethyl-1,3-diazinan-2-one;bis(trifluoromethane) (PubChem CID 162405656) has the molecular formula C8H12F6N2OZn
and a molecular weight of 331.58 g/mol. Its IUPAC name is zinc;1,3-dimethyl-1,3-diazinan-2-one;bis(trifluoromethane).
Molecular Properties
| Compound Name | zinc;1,3-dimethyl-1,3-diazinan-2-one;bis(trifluoromethane) |
| PubChem CID | 162405656 |
| Molecular Formula | C8H12F6N2OZn |
| Molecular Weight | 331.58 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | zinc;1,3-dimethyl-1,3-diazinan-2-one;bis(trifluoromethane) |
| SMILES | CN1CCCN(C)C1=O.F[C-](F)F.F[C-](F)F.[Zn+2] |
| InChI | InChI=1S/C6H12N2O.2CF3.Zn/c1-7-4-3-5-8(2)6(7)9;2*2-1(3)4;/h3-5H2,1-2H3;;;/q;2*-1;+2 |
| InChIKey | JMBWSRAWLASWHL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;1,3-dimethyl-1,3-diazinan-2-one;bis(trifluoromethane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;1,3-dimethyl-1,3-diazinan-2-one;bis(trifluoromethane)?
The IUPAC name of zinc;1,3-dimethyl-1,3-diazinan-2-one;bis(trifluoromethane) (CID 162405656) is zinc;1,3-dimethyl-1,3-diazinan-2-one;bis(trifluoromethane).
What is the SMILES notation for zinc;1,3-dimethyl-1,3-diazinan-2-one;bis(trifluoromethane)?
The canonical SMILES for zinc;1,3-dimethyl-1,3-diazinan-2-one;bis(trifluoromethane) is CN1CCCN(C)C1=O.F[C-](F)F.F[C-](F)F.[Zn+2].
What is the InChIKey of zinc;1,3-dimethyl-1,3-diazinan-2-one;bis(trifluoromethane)?
The InChIKey is JMBWSRAWLASWHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.2CF3.Zn/c1-7-4-3-5-8(2)6(7)9;2*2-1(3)4;/h3-5H2,1-2H3;;;/q;2*-1;+2.
What are the key properties of zinc;1,3-dimethyl-1,3-diazinan-2-one;bis(trifluoromethane)?
zinc;1,3-dimethyl-1,3-diazinan-2-one;bis(trifluoromethane) has a molecular weight of 331.58 g/mol, XLogP of 3.05, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;1,3-dimethyl-1,3-diazinan-2-one;bis(trifluoromethane) is sourced from PubChem (CID 162405656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).