C34H48N4 — CID 162405664
1-N,2-N-bis[[(1R,9R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]methyl]-1-N,2-N-dimethylcyclohexane-1,2-diamine (PubChem CID 162405664) has the molecular formula C34H48N4 and a molecular weight of 512.79 g/mol. Its IUPAC name is 1-N,2-N-bis[[(1R,9R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]methyl]-1-N,2-N-dimethylcyclohexane-1,2-diamine.
| Compound Name | 1-N,2-N-bis[[(1R,9R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]methyl]-1-N,2-N-dimethylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 162405664 |
| Molecular Formula | C34H48N4 |
| Molecular Weight | 512.79 g/mol |
| Exact Mass | 512.39 |
| IUPAC Name | 1-N,2-N-bis[[(1R,9R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]methyl]-1-N,2-N-dimethylcyclohexane-1,2-diamine |
| SMILES | CN(Cc1cc2c(cn1)[C@@H]1C[C@H](C2)C1(C)C)C1CCCCC1N(C)Cc1cc2c(cn1)[C@@H]1C[C@H](C2)C1(C)C |
| InChI | InChI=1S/C34H48N4/c1-33(2)23-11-21-13-25(35-17-27(21)29(33)15-23)19-37(5)31-9-7-8-10-32(31)38(6)20-26-14-22-12-24-16-30(34(24,3)4)28(22)18-36-26/h13-14,17-18,23-24,29-32H,7-12,15-16,19-20H2,1-6H3/t23-,24-,29-,30-,31?,32?/m0/s1 |
| InChIKey | IGGALMKSHLTVNF-NGOUCSLCSA-N |
| XLogP | 6.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.79 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |