C26H21NO5 — CID 162405687
(2S,3R)-2-(1,3-dioxoisoindol-2-yl)-2-(4-methoxyphenyl)-3-phenylpent-4-enoic acid (PubChem CID 162405687) has the molecular formula C26H21NO5 and a molecular weight of 427.46 g/mol. Its IUPAC name is (2S,3R)-2-(1,3-dioxoisoindol-2-yl)-2-(4-methoxyphenyl)-3-phenylpent-4-enoic acid.
| Compound Name | (2S,3R)-2-(1,3-dioxoisoindol-2-yl)-2-(4-methoxyphenyl)-3-phenylpent-4-enoic acid |
|---|---|
| PubChem CID | 162405687 |
| Molecular Formula | C26H21NO5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (2S,3R)-2-(1,3-dioxoisoindol-2-yl)-2-(4-methoxyphenyl)-3-phenylpent-4-enoic acid |
| SMILES | C=C[C@H](c1ccccc1)[C@@](C(=O)O)(c1ccc(OC)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H21NO5/c1-3-22(17-9-5-4-6-10-17)26(25(30)31,18-13-15-19(32-2)16-14-18)27-23(28)20-11-7-8-12-21(20)24(27)29/h3-16,22H,1H2,2H3,(H,30,31)/t22-,26-/m1/s1 |
| InChIKey | GFEOVKZKRXVNOG-ATIYNZHBSA-N |
| XLogP | 4.24 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|