C25H18FNO4 — CID 162405690
(2S,3R)-2-(1,3-dioxoisoindol-2-yl)-3-(4-fluorophenyl)-2-phenylpent-4-enoic acid (PubChem CID 162405690) has the molecular formula C25H18FNO4 and a molecular weight of 415.42 g/mol. Its IUPAC name is (2S,3R)-2-(1,3-dioxoisoindol-2-yl)-3-(4-fluorophenyl)-2-phenylpent-4-enoic acid.
| Compound Name | (2S,3R)-2-(1,3-dioxoisoindol-2-yl)-3-(4-fluorophenyl)-2-phenylpent-4-enoic acid |
|---|---|
| PubChem CID | 162405690 |
| Molecular Formula | C25H18FNO4 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | (2S,3R)-2-(1,3-dioxoisoindol-2-yl)-3-(4-fluorophenyl)-2-phenylpent-4-enoic acid |
| SMILES | C=C[C@H](c1ccc(F)cc1)[C@@](C(=O)O)(c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H18FNO4/c1-2-21(16-12-14-18(26)15-13-16)25(24(30)31,17-8-4-3-5-9-17)27-22(28)19-10-6-7-11-20(19)23(27)29/h2-15,21H,1H2,(H,30,31)/t21-,25-/m1/s1 |
| InChIKey | KPDFKJDAMCYEPL-PXDATVDWSA-N |
| XLogP | 4.37 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|