About 2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile
2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile (PubChem CID 162405780) has the molecular formula C20H27NO2Si
and a molecular weight of 341.53 g/mol. Its IUPAC name is 2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile.
Molecular Properties
| Compound Name | 2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile |
| PubChem CID | 162405780 |
| Molecular Formula | C20H27NO2Si |
| Molecular Weight | 341.53 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile |
| SMILES | COc1ccc(C(=O)C(C#N)C(C)(C)CCC#C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C20H27NO2Si/c1-20(2,13-7-8-14-24(4,5)6)18(15-21)19(22)16-9-11-17(23-3)12-10-16/h9-12,18H,7,13H2,1-6H3 |
| InChIKey | JJLMMHGGMMNNEA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile?
The IUPAC name of 2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile (CID 162405780) is 2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile.
What is the SMILES notation for 2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile?
The canonical SMILES for 2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile is COc1ccc(C(=O)C(C#N)C(C)(C)CCC#C[Si](C)(C)C)cc1.
What is the InChIKey of 2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile?
The InChIKey is JJLMMHGGMMNNEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO2Si/c1-20(2,13-7-8-14-24(4,5)6)18(15-21)19(22)16-9-11-17(23-3)12-10-16/h9-12,18H,7,13H2,1-6H3.
What are the key properties of 2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile?
2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile has a molecular weight of 341.53 g/mol, XLogP of 4.70, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile is sourced from PubChem (CID 162405780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).