C20H27NO2Si — CID 162405780
2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile (PubChem CID 162405780) has the molecular formula C20H27NO2Si and a molecular weight of 341.53 g/mol. Its IUPAC name is 2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile.
| Compound Name | 2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile |
|---|---|
| PubChem CID | 162405780 |
| Molecular Formula | C20H27NO2Si |
| Molecular Weight | 341.53 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 2-(4-methoxybenzoyl)-3,3-dimethyl-7-trimethylsilylhept-6-ynenitrile |
| SMILES | COc1ccc(C(=O)C(C#N)C(C)(C)CCC#C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C20H27NO2Si/c1-20(2,13-7-8-14-24(4,5)6)18(15-21)19(22)16-9-11-17(23-3)12-10-16/h9-12,18H,7,13H2,1-6H3 |
| InChIKey | JJLMMHGGMMNNEA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|